C13H14N4O5S — CID 40727991
2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 40727991) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 40727991 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanyl-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CSCC(=O)NNC(=O)c2ccco2)no1 |
| InChI | InChI=1S/C13H14N4O5S/c1-8-5-10(17-22-8)14-11(18)6-23-7-12(19)15-16-13(20)9-3-2-4-21-9/h2-5H,6-7H2,1H3,(H,15,19)(H,16,20)(H,14,17,18) |
| InChIKey | DDQRMNZVUSPWGQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|