C20H17F2N5O3S — CID 25437345
N-(4-fluorophenyl)-2-[2-[2-[3-(4-fluorophenyl)imidazole-4-carbonyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide (PubChem CID 25437345) has the molecular formula C20H17F2N5O3S and a molecular weight of 445.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[2-[3-(4-fluorophenyl)imidazole-4-carbonyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[2-[3-(4-fluorophenyl)imidazole-4-carbonyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 25437345 |
| Molecular Formula | C20H17F2N5O3S |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[2-[3-(4-fluorophenyl)imidazole-4-carbonyl]hydrazinyl]-2-oxoethyl]sulfanylacetamide |
| SMILES | O=C(CSCC(=O)Nc1ccc(F)cc1)NNC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17F2N5O3S/c21-13-1-5-15(6-2-13)24-18(28)10-31-11-19(29)25-26-20(30)17-9-23-12-27(17)16-7-3-14(22)4-8-16/h1-9,12H,10-11H2,(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | WLGMEPTZVPGOHP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|