C18H13F3N4O2S — CID 9158171
N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide (PubChem CID 9158171) has the molecular formula C18H13F3N4O2S and a molecular weight of 406.39 g/mol. Its IUPAC name is N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide.
| Compound Name | N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9158171 |
| Molecular Formula | C18H13F3N4O2S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | N'-[2-(2,5-difluorophenyl)sulfanylacetyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
| SMILES | O=C(CSc1cc(F)ccc1F)NNC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F3N4O2S/c19-11-1-4-13(5-2-11)25-10-22-8-15(25)18(27)24-23-17(26)9-28-16-7-12(20)3-6-14(16)21/h1-8,10H,9H2,(H,23,26)(H,24,27) |
| InChIKey | ASTXLZWYLXKJPC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|