C19H17FN4O4S — CID 9418541
3-(4-fluorophenyl)-N'-[4-(methylsulfonylmethyl)benzoyl]imidazole-4-carbohydrazide (PubChem CID 9418541) has the molecular formula C19H17FN4O4S and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-[4-(methylsulfonylmethyl)benzoyl]imidazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)-N'-[4-(methylsulfonylmethyl)benzoyl]imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9418541 |
| Molecular Formula | C19H17FN4O4S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-[4-(methylsulfonylmethyl)benzoyl]imidazole-4-carbohydrazide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)NNC(=O)c2cncn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H17FN4O4S/c1-29(27,28)11-13-2-4-14(5-3-13)18(25)22-23-19(26)17-10-21-12-24(17)16-8-6-15(20)7-9-16/h2-10,12H,11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | RUOCALUBBHKJDX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|