C10H9FN4O — CID 5092120
3-(4-fluorophenyl)imidazole-4-carbohydrazide (PubChem CID 5092120) has the molecular formula C10H9FN4O and a molecular weight of 220.21 g/mol. Its IUPAC name is 3-(4-fluorophenyl)imidazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 5092120 |
| Molecular Formula | C10H9FN4O |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(4-fluorophenyl)imidazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FN4O/c11-7-1-3-8(4-2-7)15-6-13-5-9(15)10(16)14-12/h1-6H,12H2,(H,14,16) |
| InChIKey | ZWCCBSUUUFLVGK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|