C13H13FN2O3 — CID 55475099
2-methoxyethyl 3-(4-fluorophenyl)imidazole-4-carboxylate (PubChem CID 55475099) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 2-methoxyethyl 3-(4-fluorophenyl)imidazole-4-carboxylate.
| Compound Name | 2-methoxyethyl 3-(4-fluorophenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 55475099 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-methoxyethyl 3-(4-fluorophenyl)imidazole-4-carboxylate |
| SMILES | COCCOC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13FN2O3/c1-18-6-7-19-13(17)12-8-15-9-16(12)11-4-2-10(14)3-5-11/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | DGPJROKJFFGFCK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|