C19H20FN3O3 — CID 18194149
[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate (PubChem CID 18194149) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate.
| Compound Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 18194149 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate |
| SMILES | CCN(C(=O)COC(=O)c1cncn1-c1ccc(F)cc1)C1=CCCC1 |
| InChI | InChI=1S/C19H20FN3O3/c1-2-22(15-5-3-4-6-15)18(24)12-26-19(25)17-11-21-13-23(17)16-9-7-14(20)8-10-16/h5,7-11,13H,2-4,6,12H2,1H3 |
| InChIKey | XJGJHHSNBCOLJW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |