C17H19N5O3 — CID 18193721
[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate (PubChem CID 18193721) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 18193721 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
| SMILES | CCN(C(=O)COC(=O)c1cccc(-n2cnnn2)c1)C1=CCCC1 |
| InChI | InChI=1S/C17H19N5O3/c1-2-21(14-7-3-4-8-14)16(23)11-25-17(24)13-6-5-9-15(10-13)22-12-18-19-20-22/h5-7,9-10,12H,2-4,8,11H2,1H3 |
| InChIKey | LTXXONNGQQQSJA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |