C15H19N5O3 — CID 42405028
[2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate (PubChem CID 42405028) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 42405028 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
| SMILES | CCC(C)(C)NC(=O)COC(=O)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H19N5O3/c1-4-15(2,3)17-13(21)9-23-14(22)11-6-5-7-12(8-11)20-10-16-18-19-20/h5-8,10H,4,9H2,1-3H3,(H,17,21) |
| InChIKey | TVGICXWJNSXLCL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |