(4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate

C15H11ClN4O2 — CID 41194676

IUPAC(4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate
SMILESO=C(OCc1ccc(Cl)cc1)c1cccc(-n2cnnn2)c1
InChIInChI=1S/C15H11ClN4O2/c16-13-6-4-11(5-7-13)9-22-15(21)12-2-1-3-14(8-12)20-10-17-18-19-20/h1-8,10H,9H2
InChIKeyJZLRYDLLFGLADE-UHFFFAOYSA-N
MW314.73 g/mol
LogP2.67
Rot. Bonds4

About (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate

(4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate (PubChem CID 41194676) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate.

Molecular Properties

Compound Name(4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate
PubChem CID41194676
Molecular FormulaC15H11ClN4O2
Molecular Weight314.73 g/mol
Exact Mass314.06
IUPAC Name(4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate
SMILESO=C(OCc1ccc(Cl)cc1)c1cccc(-n2cnnn2)c1
InChIInChI=1S/C15H11ClN4O2/c16-13-6-4-11(5-7-13)9-22-15(21)12-2-1-3-14(8-12)20-10-17-18-19-20/h1-8,10H,9H2
InChIKeyJZLRYDLLFGLADE-UHFFFAOYSA-N
XLogP2.67
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.73
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate?
The IUPAC name of (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate (CID 41194676) is (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate.
What is the SMILES notation for (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate?
The canonical SMILES for (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate is O=C(OCc1ccc(Cl)cc1)c1cccc(-n2cnnn2)c1.
What is the InChIKey of (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate?
The InChIKey is JZLRYDLLFGLADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN4O2/c16-13-6-4-11(5-7-13)9-22-15(21)12-2-1-3-14(8-12)20-10-17-18-19-20/h1-8,10H,9H2.
What are the key properties of (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate?
(4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate has a molecular weight of 314.73 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 3-(tetrazol-1-yl)benzoate is sourced from PubChem (CID 41194676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).