C18H16ClN5O3 — CID 18082117
[2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate (PubChem CID 18082117) has the molecular formula C18H16ClN5O3 and a molecular weight of 385.81 g/mol. Its IUPAC name is [2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 18082117 |
| Molecular Formula | C18H16ClN5O3 |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
| SMILES | CC(NC(=O)COC(=O)c1cccc(-n2cnnn2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClN5O3/c1-12(13-4-2-6-15(19)8-13)21-17(25)10-27-18(26)14-5-3-7-16(9-14)24-11-20-22-23-24/h2-9,11-12H,10H2,1H3,(H,21,25) |
| InChIKey | HRMUAXHSKSGXLA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |