C16H12ClN5O3 — CID 41195036
[2-(4-chloroanilino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate (PubChem CID 41195036) has the molecular formula C16H12ClN5O3 and a molecular weight of 357.76 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 41195036 |
| Molecular Formula | C16H12ClN5O3 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(-n2cnnn2)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClN5O3/c17-12-4-6-13(7-5-12)19-15(23)9-25-16(24)11-2-1-3-14(8-11)22-10-18-20-21-22/h1-8,10H,9H2,(H,19,23) |
| InChIKey | XASHLZRFNSBACH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |