C16H10F2N4O3 — CID 30431324
[2-(3,4-difluorophenyl)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate (PubChem CID 30431324) has the molecular formula C16H10F2N4O3 and a molecular weight of 344.28 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 30431324 |
| Molecular Formula | C16H10F2N4O3 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(tetrazol-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(-n2cnnn2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H10F2N4O3/c17-13-5-4-10(7-14(13)18)15(23)8-25-16(24)11-2-1-3-12(6-11)22-9-19-20-21-22/h1-7,9H,8H2 |
| InChIKey | ZQNQKHRZXGTPDE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |