C15H10F2O4 — CID 2624761
[2-(3,4-difluorophenyl)-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 2624761) has the molecular formula C15H10F2O4 and a molecular weight of 292.24 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2624761 |
| Molecular Formula | C15H10F2O4 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H10F2O4/c16-12-6-3-10(7-13(12)17)14(19)8-21-15(20)9-1-4-11(18)5-2-9/h1-7,18H,8H2 |
| InChIKey | XCFWPJYDUYUHAE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |