C19H17F2NO5S — CID 2553626
[2-(3,4-difluorophenyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2553626) has the molecular formula C19H17F2NO5S and a molecular weight of 409.41 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2553626 |
| Molecular Formula | C19H17F2NO5S |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2NO5S/c20-16-8-5-14(11-17(16)21)18(23)12-27-19(24)13-3-6-15(7-4-13)28(25,26)22-9-1-2-10-22/h3-8,11H,1-2,9-10,12H2 |
| InChIKey | JGUKTWAIKGZFIU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |