C20H19F2NO7S2 — CID 55310257
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 55310257) has the molecular formula C20H19F2NO7S2 and a molecular weight of 487.50 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 55310257 |
| Molecular Formula | C20H19F2NO7S2 |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H19F2NO7S2/c21-20(22)31(26,27)16-7-5-15(6-8-16)19(25)30-13-18(24)14-3-9-17(10-4-14)32(28,29)23-11-1-2-12-23/h3-10,20H,1-2,11-13H2 |
| InChIKey | HETRCCIQFOEMED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |