C22H25NO8S — CID 55313929
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 3,4,5-trimethoxybenzoate (PubChem CID 55313929) has the molecular formula C22H25NO8S and a molecular weight of 463.51 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 55313929 |
| Molecular Formula | C22H25NO8S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25NO8S/c1-28-19-12-16(13-20(29-2)21(19)30-3)22(25)31-14-18(24)15-6-8-17(9-7-15)32(26,27)23-10-4-5-11-23/h6-9,12-13H,4-5,10-11,14H2,1-3H3 |
| InChIKey | MBWLPBIQGLTODE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |