C21H20N2O9S — CID 55314712
1-O-methyl 3-O-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 55314712) has the molecular formula C21H20N2O9S and a molecular weight of 476.46 g/mol. Its IUPAC name is 1-O-methyl 3-O-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55314712 |
| Molecular Formula | C21H20N2O9S |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 1-O-methyl 3-O-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N2O9S/c1-31-20(25)15-10-16(12-17(11-15)23(27)28)21(26)32-13-19(24)14-4-6-18(7-5-14)33(29,30)22-8-2-3-9-22/h4-7,10-12H,2-3,8-9,13H2,1H3 |
| InChIKey | QNJSYHSEGAIGOZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 150.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|