C20H18N2O9S — CID 30990173
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 30990173) has the molecular formula C20H18N2O9S and a molecular weight of 462.44 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 30990173 |
| Molecular Formula | C20H18N2O9S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(cc1[N+](=O)[O-])OCO2)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H18N2O9S/c23-17(13-3-5-14(6-4-13)32(27,28)21-7-1-2-8-21)11-29-20(24)15-9-18-19(31-12-30-18)10-16(15)22(25)26/h3-6,9-10H,1-2,7-8,11-12H2 |
| InChIKey | YUGJMXPEWRDZBK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 142.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|