C20H19Cl2NO5S — CID 2645596
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2,3-dichlorobenzoate (PubChem CID 2645596) has the molecular formula C20H19Cl2NO5S and a molecular weight of 456.35 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 2645596 |
| Molecular Formula | C20H19Cl2NO5S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 2,3-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1Cl)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H19Cl2NO5S/c21-17-6-4-5-16(19(17)22)20(25)28-13-18(24)14-7-9-15(10-8-14)29(26,27)23-11-2-1-3-12-23/h4-10H,1-3,11-13H2 |
| InChIKey | XYIUJNJDSIYZSJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |