C19H20ClNO4S — CID 2640425
2-(2-chlorophenoxy)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone (PubChem CID 2640425) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-(2-chlorophenoxy)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 2640425 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-(2-chlorophenoxy)-1-(4-piperidin-1-ylsulfonylphenyl)ethanone |
| SMILES | O=C(COc1ccccc1Cl)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H20ClNO4S/c20-17-6-2-3-7-19(17)25-14-18(22)15-8-10-16(11-9-15)26(23,24)21-12-4-1-5-13-21/h2-3,6-11H,1,4-5,12-14H2 |
| InChIKey | ZGMCHBIIGTVZRR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |