C20H19Cl2NO5S — CID 2640566
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3,4-dichlorobenzoate (PubChem CID 2640566) has the molecular formula C20H19Cl2NO5S and a molecular weight of 456.35 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3,4-dichlorobenzoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 2640566 |
| Molecular Formula | C20H19Cl2NO5S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3,4-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(Cl)c1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H19Cl2NO5S/c21-17-9-6-15(12-18(17)22)20(25)28-13-19(24)14-4-7-16(8-5-14)29(26,27)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11,13H2 |
| InChIKey | CSAQHCMHJGDFOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |