C20H20BrNO5S — CID 23912244
[2-(3-bromophenyl)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 23912244) has the molecular formula C20H20BrNO5S and a molecular weight of 466.35 g/mol. Its IUPAC name is [2-(3-bromophenyl)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(3-bromophenyl)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 23912244 |
| Molecular Formula | C20H20BrNO5S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | [2-(3-bromophenyl)-2-oxoethyl] 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H20BrNO5S/c21-17-6-4-5-16(13-17)19(23)14-27-20(24)15-7-9-18(10-8-15)28(25,26)22-11-2-1-3-12-22/h4-10,13H,1-3,11-12,14H2 |
| InChIKey | QIIFMTLDWRIMKX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |