C17H17BrN2O5S — CID 35487813
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-bromo-1H-pyrrole-2-carboxylate (PubChem CID 35487813) has the molecular formula C17H17BrN2O5S and a molecular weight of 441.30 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-bromo-1H-pyrrole-2-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-bromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 35487813 |
| Molecular Formula | C17H17BrN2O5S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 4-bromo-1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Br)c[nH]1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H17BrN2O5S/c18-13-9-15(19-10-13)17(22)25-11-16(21)12-3-5-14(6-4-12)26(23,24)20-7-1-2-8-20/h3-6,9-10,19H,1-2,7-8,11H2 |
| InChIKey | KDYHEJUUNAWGQG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |