C26H24FNO6S — CID 42967136
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 42967136) has the molecular formula C26H24FNO6S and a molecular weight of 497.54 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-[(4-fluorophenyl)methoxy]benzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-[(4-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 42967136 |
| Molecular Formula | C26H24FNO6S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccc(F)cc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H24FNO6S/c27-21-11-7-19(8-12-21)17-33-25-6-2-1-5-23(25)26(30)34-18-24(29)20-9-13-22(14-10-20)35(31,32)28-15-3-4-16-28/h1-2,5-14H,3-4,15-18H2 |
| InChIKey | UGBIQBIHZPVCCX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |