C24H27FN2O5S — CID 42988770
[2-(4-fluorophenyl)-2-oxoethyl] 5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzoate (PubChem CID 42988770) has the molecular formula C24H27FN2O5S and a molecular weight of 474.55 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 42988770 |
| Molecular Formula | C24H27FN2O5S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H27FN2O5S/c25-19-8-6-18(7-9-19)23(28)17-32-24(29)21-16-20(10-11-22(21)26-12-4-5-13-26)33(30,31)27-14-2-1-3-15-27/h6-11,16H,1-5,12-15,17H2 |
| InChIKey | DXKVKUKDRKQGSS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |