About phenacyl 2-phenylmethoxybenzoate
phenacyl 2-phenylmethoxybenzoate (PubChem CID 2565163) has the molecular formula C22H18O4
and a molecular weight of 346.38 g/mol. Its IUPAC name is phenacyl 2-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | phenacyl 2-phenylmethoxybenzoate |
| PubChem CID | 2565163 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | phenacyl 2-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18O4/c23-20(18-11-5-2-6-12-18)16-26-22(24)19-13-7-8-14-21(19)25-15-17-9-3-1-4-10-17/h1-14H,15-16H2 |
| InChIKey | FTOPOGRYDGQDDB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenacyl 2-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 2-phenylmethoxybenzoate?
The IUPAC name of phenacyl 2-phenylmethoxybenzoate (CID 2565163) is phenacyl 2-phenylmethoxybenzoate.
What is the SMILES notation for phenacyl 2-phenylmethoxybenzoate?
The canonical SMILES for phenacyl 2-phenylmethoxybenzoate is O=C(COC(=O)c1ccccc1OCc1ccccc1)c1ccccc1.
What is the InChIKey of phenacyl 2-phenylmethoxybenzoate?
The InChIKey is FTOPOGRYDGQDDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O4/c23-20(18-11-5-2-6-12-18)16-26-22(24)19-13-7-8-14-21(19)25-15-17-9-3-1-4-10-17/h1-14H,15-16H2.
What are the key properties of phenacyl 2-phenylmethoxybenzoate?
phenacyl 2-phenylmethoxybenzoate has a molecular weight of 346.38 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-phenylmethoxybenzoate is sourced from PubChem (CID 2565163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).