About [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate
[2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate (PubChem CID 7718124) has the molecular formula C26H28O4
and a molecular weight of 404.51 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate |
| PubChem CID | 7718124 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate |
| SMILES | O=C(OCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H28O4/c27-24(26-13-19-10-20(14-26)12-21(11-19)15-26)17-30-25(28)22-8-4-5-9-23(22)29-16-18-6-2-1-3-7-18/h1-9,19-21H,10-17H2 |
| InChIKey | LECDZRXWFXNFDH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
The IUPAC name of [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate (CID 7718124) is [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate.
What is the SMILES notation for [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
The canonical SMILES for [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate is O=C(OCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1OCc1ccccc1.
What is the InChIKey of [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
The InChIKey is LECDZRXWFXNFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28O4/c27-24(26-13-19-10-20(14-26)12-21(11-19)15-26)17-30-25(28)22-8-4-5-9-23(22)29-16-18-6-2-1-3-7-18/h1-9,19-21H,10-17H2.
What are the key properties of [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate?
[2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate has a molecular weight of 404.51 g/mol, XLogP of 5.21, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-adamantyl)-2-oxoethyl] 2-phenylmethoxybenzoate is sourced from PubChem (CID 7718124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).