C22H21NO4S — CID 28562265
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-phenylmethoxybenzoate (PubChem CID 28562265) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-phenylmethoxybenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 28562265 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1OCc1ccccc1)NCCc1cccs1 |
| InChI | InChI=1S/C22H21NO4S/c24-21(23-13-12-18-9-6-14-28-18)16-27-22(25)19-10-4-5-11-20(19)26-15-17-7-2-1-3-8-17/h1-11,14H,12-13,15-16H2,(H,23,24) |
| InChIKey | LIXREMDAPCDQAW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |