C15H14FNO3S — CID 8861267
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-fluorobenzoate (PubChem CID 8861267) has the molecular formula C15H14FNO3S and a molecular weight of 307.35 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-fluorobenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 8861267 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C15H14FNO3S/c16-12-5-3-11(4-6-12)15(19)20-10-14(18)17-8-7-13-2-1-9-21-13/h1-6,9H,7-8,10H2,(H,17,18) |
| InChIKey | SKVYQHLYUGGBMK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |