C20H25N3O4S — CID 7735138
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate (PubChem CID 7735138) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 7735138 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 4-[(propan-2-ylcarbamoylamino)methyl]benzoate |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)OCC(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-14(2)23-20(26)22-12-15-5-7-16(8-6-15)19(25)27-13-18(24)21-10-9-17-4-3-11-28-17/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,21,24)(H2,22,23,26) |
| InChIKey | ORNRNVPYRMWNBH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |