C19H25N3O2S2 — CID 9472075
4-[(propan-2-ylcarbamoylamino)methyl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 9472075) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 4-[(propan-2-ylcarbamoylamino)methyl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 4-[(propan-2-ylcarbamoylamino)methyl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 9472075 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[(propan-2-ylcarbamoylamino)methyl]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | CC(C)NC(=O)NCc1ccc(C(=O)NCCSCc2cccs2)cc1 |
| InChI | InChI=1S/C19H25N3O2S2/c1-14(2)22-19(24)21-12-15-5-7-16(8-6-15)18(23)20-9-11-25-13-17-4-3-10-26-17/h3-8,10,14H,9,11-13H2,1-2H3,(H,20,23)(H2,21,22,24) |
| InChIKey | CANCGLMVNQIVDQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|