C15H18N2O3S3 — CID 17443070
4-(methylsulfamoyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 17443070) has the molecular formula C15H18N2O3S3 and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-(methylsulfamoyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 4-(methylsulfamoyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 17443070 |
| Molecular Formula | C15H18N2O3S3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-(methylsulfamoyl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NCCSCc2cccs2)cc1 |
| InChI | InChI=1S/C15H18N2O3S3/c1-16-23(19,20)14-6-4-12(5-7-14)15(18)17-8-10-21-11-13-3-2-9-22-13/h2-7,9,16H,8,10-11H2,1H3,(H,17,18) |
| InChIKey | JYBSKNZMROTFHG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|