C15H17NO3S3 — CID 8814206
3-acetyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 8814206) has the molecular formula C15H17NO3S3 and a molecular weight of 355.51 g/mol. Its IUPAC name is 3-acetyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8814206 |
| Molecular Formula | C15H17NO3S3 |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-acetyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCCSCc2cccs2)c1 |
| InChI | InChI=1S/C15H17NO3S3/c1-12(17)13-4-2-6-15(10-13)22(18,19)16-7-9-20-11-14-5-3-8-21-14/h2-6,8,10,16H,7,9,11H2,1H3 |
| InChIKey | PXOMLCIUONRQDB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|