C14H16BrNO2S3 — CID 8814279
4-bromo-3-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 8814279) has the molecular formula C14H16BrNO2S3 and a molecular weight of 406.39 g/mol. Its IUPAC name is 4-bromo-3-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-3-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8814279 |
| Molecular Formula | C14H16BrNO2S3 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 4-bromo-3-methyl-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCSCc2cccs2)ccc1Br |
| InChI | InChI=1S/C14H16BrNO2S3/c1-11-9-13(4-5-14(11)15)21(17,18)16-6-8-19-10-12-3-2-7-20-12/h2-5,7,9,16H,6,8,10H2,1H3 |
| InChIKey | WTNKJYVOZQXTTN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|