C15H15BrClNO2S — CID 60640413
4-bromo-N-[2-(4-chlorophenyl)ethyl]-3-methylbenzenesulfonamide (PubChem CID 60640413) has the molecular formula C15H15BrClNO2S and a molecular weight of 388.71 g/mol. Its IUPAC name is 4-bromo-N-[2-(4-chlorophenyl)ethyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(4-chlorophenyl)ethyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60640413 |
| Molecular Formula | C15H15BrClNO2S |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 4-bromo-N-[2-(4-chlorophenyl)ethyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCc2ccc(Cl)cc2)ccc1Br |
| InChI | InChI=1S/C15H15BrClNO2S/c1-11-10-14(6-7-15(11)16)21(19,20)18-9-8-12-2-4-13(17)5-3-12/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | AYRPHTHYRQLNAM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |