C14H13Cl2NO4S2 — CID 15166823
4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]benzenesulfonyl chloride (PubChem CID 15166823) has the molecular formula C14H13Cl2NO4S2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]benzenesulfonyl chloride.
| Compound Name | 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 15166823 |
| Molecular Formula | C14H13Cl2NO4S2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H13Cl2NO4S2/c15-12-3-7-14(8-4-12)23(20,21)17-10-9-11-1-5-13(6-2-11)22(16,18)19/h1-8,17H,9-10H2 |
| InChIKey | ZFOBKPNTUIOOIS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |