About acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate
acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate (PubChem CID 174293454) has the molecular formula C16H19ClN2O3S
and a molecular weight of 354.86 g/mol. Its IUPAC name is acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate.
Molecular Properties
| Compound Name | acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate |
| PubChem CID | 174293454 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate |
| SMILES | CC#N.O.O=S(=O)(NCCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClNO2S.C2H3N.H2O/c15-13-6-8-14(9-7-13)19(17,18)16-11-10-12-4-2-1-3-5-12;1-2-3;/h1-9,16H,10-11H2;1H3;1H2 |
| InChIKey | QBYCCDWIRKZQPB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate?
The IUPAC name of acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate (CID 174293454) is acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate.
What is the SMILES notation for acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate?
The canonical SMILES for acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate is CC#N.O.O=S(=O)(NCCc1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate?
The InChIKey is QBYCCDWIRKZQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO2S.C2H3N.H2O/c15-13-6-8-14(9-7-13)19(17,18)16-11-10-12-4-2-1-3-5-12;1-2-3;/h1-9,16H,10-11H2;1H3;1H2.
What are the key properties of acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate?
acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate has a molecular weight of 354.86 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;4-chloro-N-(2-phenylethyl)benzenesulfonamide;hydrate is sourced from PubChem (CID 174293454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).