C22H22ClNO4S2 — CID 57430116
5-(4-chlorophenyl)sulfonyl-2-methyl-N-[2-(4-methylphenyl)ethyl]benzenesulfonamide (PubChem CID 57430116) has the molecular formula C22H22ClNO4S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-2-methyl-N-[2-(4-methylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-2-methyl-N-[2-(4-methylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57430116 |
| Molecular Formula | C22H22ClNO4S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-2-methyl-N-[2-(4-methylphenyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(CCNS(=O)(=O)c2cc(S(=O)(=O)c3ccc(Cl)cc3)ccc2C)cc1 |
| InChI | InChI=1S/C22H22ClNO4S2/c1-16-3-6-18(7-4-16)13-14-24-30(27,28)22-15-21(10-5-17(22)2)29(25,26)20-11-8-19(23)9-12-20/h3-12,15,24H,13-14H2,1-2H3 |
| InChIKey | YPZBTMPEOKVOOU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |