C13H12ClNO4S2 — CID 877222
5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide (PubChem CID 877222) has the molecular formula C13H12ClNO4S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 877222 |
| Molecular Formula | C13H12ClNO4S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H12ClNO4S2/c1-9-2-5-12(8-13(9)21(15,18)19)20(16,17)11-6-3-10(14)4-7-11/h2-8H,1H3,(H2,15,18,19) |
| InChIKey | NCTDHZPYRJQSNF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |