C11H10ClNO4S3 — CID 76852484
5-(4-chlorophenyl)sulfonyl-4-methylthiophene-2-sulfonamide (PubChem CID 76852484) has the molecular formula C11H10ClNO4S3 and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfonyl-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-(4-chlorophenyl)sulfonyl-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 76852484 |
| Molecular Formula | C11H10ClNO4S3 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 5-(4-chlorophenyl)sulfonyl-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)sc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10ClNO4S3/c1-7-6-10(20(13,16)17)18-11(7)19(14,15)9-4-2-8(12)3-5-9/h2-6H,1H3,(H2,13,16,17) |
| InChIKey | PTKBZZGXJMQYOT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |