C6H8N2O3S2 — CID 130619284
3-methyl-5-sulfamoylthiophene-2-carboxamide (PubChem CID 130619284) has the molecular formula C6H8N2O3S2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-methyl-5-sulfamoylthiophene-2-carboxamide.
| Compound Name | 3-methyl-5-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 130619284 |
| Molecular Formula | C6H8N2O3S2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 3-methyl-5-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1cc(S(N)(=O)=O)sc1C(N)=O |
| InChI | InChI=1S/C6H8N2O3S2/c1-3-2-4(13(8,10)11)12-5(3)6(7)9/h2H,1H3,(H2,7,9)(H2,8,10,11) |
| InChIKey | IZKKLRFQLABKBE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |