C7H9NO4S2 — CID 69128719
2-ethyl-5-sulfamoylthiophene-3-carboxylic acid (PubChem CID 69128719) has the molecular formula C7H9NO4S2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-ethyl-5-sulfamoylthiophene-3-carboxylic acid.
| Compound Name | 2-ethyl-5-sulfamoylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 69128719 |
| Molecular Formula | C7H9NO4S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 2-ethyl-5-sulfamoylthiophene-3-carboxylic acid |
| SMILES | CCc1sc(S(N)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C7H9NO4S2/c1-2-5-4(7(9)10)3-6(13-5)14(8,11)12/h3H,2H2,1H3,(H,9,10)(H2,8,11,12) |
| InChIKey | XBWGBXKCBYUTFT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |