C14H16N2O4S2 — CID 21499400
4-ethyl-5-sulfamoyl-2-(thiophen-2-ylmethylamino)benzoic acid (PubChem CID 21499400) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-ethyl-5-sulfamoyl-2-(thiophen-2-ylmethylamino)benzoic acid.
| Compound Name | 4-ethyl-5-sulfamoyl-2-(thiophen-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 21499400 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-ethyl-5-sulfamoyl-2-(thiophen-2-ylmethylamino)benzoic acid |
| SMILES | CCc1cc(NCc2cccs2)c(C(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H16N2O4S2/c1-2-9-6-12(16-8-10-4-3-5-21-10)11(14(17)18)7-13(9)22(15,19)20/h3-7,16H,2,8H2,1H3,(H,17,18)(H2,15,19,20) |
| InChIKey | VZEUFFOSYOWDNK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |