C15H18N2O4S2 — CID 54552550
2-[(4-propan-2-ylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid (PubChem CID 54552550) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(4-propan-2-ylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[(4-propan-2-ylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 54552550 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-[(4-propan-2-ylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid |
| SMILES | CC(C)c1csc(CNc2ccc(S(N)(=O)=O)cc2C(=O)O)c1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-9(2)10-5-11(22-8-10)7-17-14-4-3-12(23(16,20)21)6-13(14)15(18)19/h3-6,8-9,17H,7H2,1-2H3,(H,18,19)(H2,16,20,21) |
| InChIKey | ZKXMNHOPTQKNBQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |