C16H20N2O4S2 — CID 54072413
2-[(4-butylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid (PubChem CID 54072413) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[(4-butylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[(4-butylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 54072413 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[(4-butylthiophen-2-yl)methylamino]-5-sulfamoylbenzoic acid |
| SMILES | CCCCc1csc(CNc2ccc(S(N)(=O)=O)cc2C(=O)O)c1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-2-3-4-11-7-12(23-10-11)9-18-15-6-5-13(24(17,21)22)8-14(15)16(19)20/h5-8,10,18H,2-4,9H2,1H3,(H,19,20)(H2,17,21,22) |
| InChIKey | MHJIDKQGUMANBT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |