C7H9NO5S2 — CID 127020813
5-[hydroxy(methyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 127020813) has the molecular formula C7H9NO5S2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-[hydroxy(methyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[hydroxy(methyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 127020813 |
| Molecular Formula | C7H9NO5S2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 5-[hydroxy(methyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N(C)O)sc1C(=O)O |
| InChI | InChI=1S/C7H9NO5S2/c1-4-3-5(14-6(4)7(9)10)15(12,13)8(2)11/h3,11H,1-2H3,(H,9,10) |
| InChIKey | CDEFKPKRDKWAOG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|