C9H12N2O3S — CID 65373668
2,3-dimethyl-5-sulfamoylbenzamide (PubChem CID 65373668) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2,3-dimethyl-5-sulfamoylbenzamide.
| Compound Name | 2,3-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65373668 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2,3-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(C(N)=O)c1C |
| InChI | InChI=1S/C9H12N2O3S/c1-5-3-7(15(11,13)14)4-8(6(5)2)9(10)12/h3-4H,1-2H3,(H2,10,12)(H2,11,13,14) |
| InChIKey | QLEIFMBDSVIBSF-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |