C10H14N2O3S — CID 155439056
2,3-dimethyl-5-(methylsulfamoyl)benzamide (PubChem CID 155439056) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2,3-dimethyl-5-(methylsulfamoyl)benzamide.
| Compound Name | 2,3-dimethyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 155439056 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2,3-dimethyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C)c(C)c(C(N)=O)c1 |
| InChI | InChI=1S/C10H14N2O3S/c1-6-4-8(16(14,15)12-3)5-9(7(6)2)10(11)13/h4-5,12H,1-3H3,(H2,11,13) |
| InChIKey | SLIQOMHIXKOYHJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |