C8H7F2NO4S — CID 68839247
2,3-difluoro-5-(methylsulfamoyl)benzoic acid (PubChem CID 68839247) has the molecular formula C8H7F2NO4S and a molecular weight of 251.21 g/mol. Its IUPAC name is 2,3-difluoro-5-(methylsulfamoyl)benzoic acid.
| Compound Name | 2,3-difluoro-5-(methylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 68839247 |
| Molecular Formula | C8H7F2NO4S |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 2,3-difluoro-5-(methylsulfamoyl)benzoic acid |
| SMILES | CNS(=O)(=O)c1cc(F)c(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H7F2NO4S/c1-11-16(14,15)4-2-5(8(12)13)7(10)6(9)3-4/h2-3,11H,1H3,(H,12,13) |
| InChIKey | BGKWSXDTAWJLBX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |